Result Type

You Searched For: N-(6-Chloro-2-pyridinyl)-N,N-dimethylamine

1  results were found

Microchem by AlphaTec Chemical Permeation Guide 20

Chemical Permeation Guide What is permeation? Permeation is the process by which a potentially hazardous chemical moves through a material on a molecular level. Molecules of chemical adsorb onto the outer surface of the material. They then enter a...