You Searched For: N-(6-Chloro-2-pyridinyl)-N,N-diethylamine
2 results were found
Microchem by AlphaTec Chemical Permeation Guide 20
/m-us.vwr.com/en_US/images/Microchem_by_AlphaTec_Chemical_Permeation_Guide_20.pdf
Chemical Permeation Guide What is permeation? Permeation is the process by which a potentially hazardous chemical moves through a material on a molecular level. Molecules of chemical adsorb onto the outer surface of the material. They then enter a...
Ansell Chemical Glove Resistance Guide Aug 2016
/m-us.vwr.com/en_US/images/Ansell_Chemical_Glove_Resistance_Guide_Aug_2016.pdf
CHEMICAL GLOVE RESISTANCE GUIDE DEFINITION OF KEY TERMS Permeation is a process by which a chemical can pass through a protective film without going through pinholes pores or other visible openings. Individual molecules of the chemical enter the f...